C20H19ClN2O4S — CID 14347851
3-[4-[(3-chlorophenyl)sulfonylamino]-4,5-dihydro-3H-benzo[cd]indol-1-yl]propanoic acid (PubChem CID 14347851) has the molecular formula C20H19ClN2O4S and a molecular weight of 418.90 g/mol. Its IUPAC name is 3-[4-[(3-chlorophenyl)sulfonylamino]-4,5-dihydro-3H-benzo[cd]indol-1-yl]propanoic acid.
| Compound Name | 3-[4-[(3-chlorophenyl)sulfonylamino]-4,5-dihydro-3H-benzo[cd]indol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 14347851 |
| Molecular Formula | C20H19ClN2O4S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 3-[4-[(3-chlorophenyl)sulfonylamino]-4,5-dihydro-3H-benzo[cd]indol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1cc2c3c(cccc31)CC(NS(=O)(=O)c1cccc(Cl)c1)C2 |
| InChI | InChI=1S/C20H19ClN2O4S/c21-15-4-2-5-17(11-15)28(26,27)22-16-9-13-3-1-6-18-20(13)14(10-16)12-23(18)8-7-19(24)25/h1-6,11-12,16,22H,7-10H2,(H,24,25) |
| InChIKey | GYFNSLNHOGKPEG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|