C26H28F3N9O3 — CID 143480072
1-[4-[(4aS)-4-amino-6-(methoxymethyl)-7-[(3-oxopiperazin-1-yl)methyl]-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea (PubChem CID 143480072) has the molecular formula C26H28F3N9O3 and a molecular weight of 571.56 g/mol. Its IUPAC name is 1-[4-[(4aS)-4-amino-6-(methoxymethyl)-7-[(3-oxopiperazin-1-yl)methyl]-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea.
| Compound Name | 1-[4-[(4aS)-4-amino-6-(methoxymethyl)-7-[(3-oxopiperazin-1-yl)methyl]-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 143480072 |
| Molecular Formula | C26H28F3N9O3 |
| Molecular Weight | 571.56 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | 1-[4-[(4aS)-4-amino-6-(methoxymethyl)-7-[(3-oxopiperazin-1-yl)methyl]-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[4-(trifluoromethyl)-2-pyridinyl]urea |
| SMILES | COCC1=C(CN2CCNC(=O)C2)N2N=CN=C(N)[C@@H]2C1c1ccc(NC(=O)Nc2cc(C(F)(F)F)ccn2)cc1 |
| InChI | InChI=1S/C26H28F3N9O3/c1-41-13-18-19(11-37-9-8-32-21(39)12-37)38-23(24(30)33-14-34-38)22(18)15-2-4-17(5-3-15)35-25(40)36-20-10-16(6-7-31-20)26(27,28)29/h2-7,10,14,22-23H,8-9,11-13H2,1H3,(H,32,39)(H2,30,33,34)(H2,31,35,36,40)/t22?,23-/m0/s1 |
| InChIKey | NGZAYGGGLGOAEY-WCSIJFPASA-N |
| XLogP | 2.16 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |