C29H34F4N8O3 — CID 67992632
1-[4-[4-amino-6-[(2-methoxyethylamino)methyl]-7-(morpholin-4-ylmethyl)-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 67992632) has the molecular formula C29H34F4N8O3 and a molecular weight of 618.64 g/mol. Its IUPAC name is 1-[4-[4-amino-6-[(2-methoxyethylamino)methyl]-7-(morpholin-4-ylmethyl)-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[4-amino-6-[(2-methoxyethylamino)methyl]-7-(morpholin-4-ylmethyl)-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 67992632 |
| Molecular Formula | C29H34F4N8O3 |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | 1-[4-[4-amino-6-[(2-methoxyethylamino)methyl]-7-(morpholin-4-ylmethyl)-4a,5-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | COCCNCC1=C(CN2CCOCC2)N2N=CN=C(N)C2C1c1ccc(NC(=O)Nc2cc(C(F)(F)F)ccc2F)cc1 |
| InChI | InChI=1S/C29H34F4N8O3/c1-43-11-8-35-15-21-24(16-40-9-12-44-13-10-40)41-26(27(34)36-17-37-41)25(21)18-2-5-20(6-3-18)38-28(42)39-23-14-19(29(31,32)33)4-7-22(23)30/h2-7,14,17,25-26,35H,8-13,15-16H2,1H3,(H2,34,36,37)(H2,38,39,42) |
| InChIKey | YEZLTTRLTHAJMV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|