C16H25NS2 — CID 143481204
(2Z,4Z,7Z)-1,6-dimethyl-6-methylsulfanyl-3-piperidin-4-ylcycloocta-2,4,7-triene-1-thiol (PubChem CID 143481204) has the molecular formula C16H25NS2 and a molecular weight of 295.52 g/mol. Its IUPAC name is (2Z,4Z,7Z)-1,6-dimethyl-6-methylsulfanyl-3-piperidin-4-ylcycloocta-2,4,7-triene-1-thiol.
| Compound Name | (2Z,4Z,7Z)-1,6-dimethyl-6-methylsulfanyl-3-piperidin-4-ylcycloocta-2,4,7-triene-1-thiol |
|---|---|
| PubChem CID | 143481204 |
| Molecular Formula | C16H25NS2 |
| Molecular Weight | 295.52 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (2Z,4Z,7Z)-1,6-dimethyl-6-methylsulfanyl-3-piperidin-4-ylcycloocta-2,4,7-triene-1-thiol |
| SMILES | CSC1(C)/C=C\C(C2CCNCC2)=C/C(C)(S)/C=C\1 |
| InChI | InChI=1S/C16H25NS2/c1-15(18)8-9-16(2,19-3)7-4-14(12-15)13-5-10-17-11-6-13/h4,7-9,12-13,17-18H,5-6,10-11H2,1-3H3/b7-4-,9-8-,14-12+ |
| InChIKey | SLCLDEWSHRKRSO-DNOFWHPHSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|