C13H21NS — CID 170568270
4-[(3E,5Z)-4-methylsulfanylhepta-1,3,5-trien-2-yl]piperidine (PubChem CID 170568270) has the molecular formula C13H21NS and a molecular weight of 223.39 g/mol. Its IUPAC name is 4-[(3E,5Z)-4-methylsulfanylhepta-1,3,5-trien-2-yl]piperidine.
| Compound Name | 4-[(3E,5Z)-4-methylsulfanylhepta-1,3,5-trien-2-yl]piperidine |
|---|---|
| PubChem CID | 170568270 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.39 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 4-[(3E,5Z)-4-methylsulfanylhepta-1,3,5-trien-2-yl]piperidine |
| SMILES | C=C(/C=C(\C=C/C)SC)C1CCNCC1 |
| InChI | InChI=1S/C13H21NS/c1-4-5-13(15-3)10-11(2)12-6-8-14-9-7-12/h4-5,10,12,14H,2,6-9H2,1,3H3/b5-4-,13-10+ |
| InChIKey | YZBABXJWVCNTSZ-GNPUEAEQSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|