C11H19N — CID 123237175
4-(4-methylpenta-2,4-dien-2-yl)piperidine (PubChem CID 123237175) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is 4-(4-methylpenta-2,4-dien-2-yl)piperidine.
| Compound Name | 4-(4-methylpenta-2,4-dien-2-yl)piperidine |
|---|---|
| PubChem CID | 123237175 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 4-(4-methylpenta-2,4-dien-2-yl)piperidine |
| SMILES | C=C(C)C=C(C)C1CCNCC1 |
| InChI | InChI=1S/C11H19N/c1-9(2)8-10(3)11-4-6-12-7-5-11/h8,11-12H,1,4-7H2,2-3H3 |
| InChIKey | LFIULCLKQKFHNP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|