C11H17N — CID 123221564
4-hexa-1,3,5-trien-3-ylpiperidine (PubChem CID 123221564) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 4-hexa-1,3,5-trien-3-ylpiperidine.
| Compound Name | 4-hexa-1,3,5-trien-3-ylpiperidine |
|---|---|
| PubChem CID | 123221564 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 4-hexa-1,3,5-trien-3-ylpiperidine |
| SMILES | C=CC=C(C=C)C1CCNCC1 |
| InChI | InChI=1S/C11H17N/c1-3-5-10(4-2)11-6-8-12-9-7-11/h3-5,11-12H,1-2,6-9H2 |
| InChIKey | KMLFSCIRPSLZSP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|