C18H28FNO2 — CID 143486973
methyl N-[(4R,5S)-4-(3-fluorophenyl)-5-methylnonyl]carbamate (PubChem CID 143486973) has the molecular formula C18H28FNO2 and a molecular weight of 309.43 g/mol. Its IUPAC name is methyl N-[(4R,5S)-4-(3-fluorophenyl)-5-methylnonyl]carbamate.
| Compound Name | methyl N-[(4R,5S)-4-(3-fluorophenyl)-5-methylnonyl]carbamate |
|---|---|
| PubChem CID | 143486973 |
| Molecular Formula | C18H28FNO2 |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | methyl N-[(4R,5S)-4-(3-fluorophenyl)-5-methylnonyl]carbamate |
| SMILES | CCCC[C@H](C)[C@@H](CCCNC(=O)OC)c1cccc(F)c1 |
| InChI | InChI=1S/C18H28FNO2/c1-4-5-8-14(2)17(11-7-12-20-18(21)22-3)15-9-6-10-16(19)13-15/h6,9-10,13-14,17H,4-5,7-8,11-12H2,1-3H3,(H,20,21)/t14-,17+/m0/s1 |
| InChIKey | PRYSPEASPLMULO-WMLDXEAASA-N |
| XLogP | 4.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|