C12H19NO4 — CID 143489553
N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]formamide;3-methoxypropanoic acid (PubChem CID 143489553) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]formamide;3-methoxypropanoic acid.
| Compound Name | N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]formamide;3-methoxypropanoic acid |
|---|---|
| PubChem CID | 143489553 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]formamide;3-methoxypropanoic acid |
| SMILES | C=C/C(=C\C=C/C)NC=O.COCCC(=O)O |
| InChI | InChI=1S/C8H11NO.C4H8O3/c1-3-5-6-8(4-2)9-7-10;1-7-3-2-4(5)6/h3-7H,2H2,1H3,(H,9,10);2-3H2,1H3,(H,5,6)/b5-3-,8-6+; |
| InChIKey | HBSGRHSBJYTJBA-MQASBHRKSA-N |
| XLogP | 1.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|