C14H22N2O2 — CID 176933591
N-formyl-4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]-methylamino]pentanamide (PubChem CID 176933591) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is N-formyl-4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]-methylamino]pentanamide.
| Compound Name | N-formyl-4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]-methylamino]pentanamide |
|---|---|
| PubChem CID | 176933591 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N-formyl-4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]-methylamino]pentanamide |
| SMILES | C=C/C(=C\C=C/C)N(C)C(C)CCC(=O)NC=O |
| InChI | InChI=1S/C14H22N2O2/c1-5-7-8-13(6-2)16(4)12(3)9-10-14(18)15-11-17/h5-8,11-12H,2,9-10H2,1,3-4H3,(H,15,17,18)/b7-5-,13-8+ |
| InChIKey | GJSOBIBJTPSBAG-IPYMFYIGSA-N |
| XLogP | 2.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|