C17H21FN2O2 — CID 169257859
N-ethenyl-4-[1-(2-fluoro-6-formylphenyl)ethenyl-methylamino]pentanamide (PubChem CID 169257859) has the molecular formula C17H21FN2O2 and a molecular weight of 304.37 g/mol. Its IUPAC name is N-ethenyl-4-[1-(2-fluoro-6-formylphenyl)ethenyl-methylamino]pentanamide.
| Compound Name | N-ethenyl-4-[1-(2-fluoro-6-formylphenyl)ethenyl-methylamino]pentanamide |
|---|---|
| PubChem CID | 169257859 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-ethenyl-4-[1-(2-fluoro-6-formylphenyl)ethenyl-methylamino]pentanamide |
| SMILES | C=CNC(=O)CCC(C)N(C)C(=C)c1c(F)cccc1C=O |
| InChI | InChI=1S/C17H21FN2O2/c1-5-19-16(22)10-9-12(2)20(4)13(3)17-14(11-21)7-6-8-15(17)18/h5-8,11-12H,1,3,9-10H2,2,4H3,(H,19,22) |
| InChIKey | MBNNLALMYJEDFN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|