C18H19BrN2O3 — CID 167470285
4-[(4-bromo-8-formylnaphthalen-1-yl)-methylamino]-N-formylpentanamide (PubChem CID 167470285) has the molecular formula C18H19BrN2O3 and a molecular weight of 391.27 g/mol. Its IUPAC name is 4-[(4-bromo-8-formylnaphthalen-1-yl)-methylamino]-N-formylpentanamide.
| Compound Name | 4-[(4-bromo-8-formylnaphthalen-1-yl)-methylamino]-N-formylpentanamide |
|---|---|
| PubChem CID | 167470285 |
| Molecular Formula | C18H19BrN2O3 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 4-[(4-bromo-8-formylnaphthalen-1-yl)-methylamino]-N-formylpentanamide |
| SMILES | CC(CCC(=O)NC=O)N(C)c1ccc(Br)c2cccc(C=O)c12 |
| InChI | InChI=1S/C18H19BrN2O3/c1-12(6-9-17(24)20-11-23)21(2)16-8-7-15(19)14-5-3-4-13(10-22)18(14)16/h3-5,7-8,10-12H,6,9H2,1-2H3,(H,20,23,24) |
| InChIKey | XKEWZXQWEUMDNY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|