C24H40N4O3 — CID 163862440
(4S)-4-[3-[(E)-6-(dimethylamino)-2-methylhex-3-en-3-yl]-2-[hydroxymethyl(methyl)amino]-N-methylanilino]-N-formylpentanamide (PubChem CID 163862440) has the molecular formula C24H40N4O3 and a molecular weight of 432.61 g/mol. Its IUPAC name is (4S)-4-[3-[(E)-6-(dimethylamino)-2-methylhex-3-en-3-yl]-2-[hydroxymethyl(methyl)amino]-N-methylanilino]-N-formylpentanamide.
| Compound Name | (4S)-4-[3-[(E)-6-(dimethylamino)-2-methylhex-3-en-3-yl]-2-[hydroxymethyl(methyl)amino]-N-methylanilino]-N-formylpentanamide |
|---|---|
| PubChem CID | 163862440 |
| Molecular Formula | C24H40N4O3 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (4S)-4-[3-[(E)-6-(dimethylamino)-2-methylhex-3-en-3-yl]-2-[hydroxymethyl(methyl)amino]-N-methylanilino]-N-formylpentanamide |
| SMILES | CC(C)/C(=C\CCN(C)C)c1cccc(N(C)[C@@H](C)CCC(=O)NC=O)c1N(C)CO |
| InChI | InChI=1S/C24H40N4O3/c1-18(2)20(11-9-15-26(4)5)21-10-8-12-22(24(21)27(6)17-30)28(7)19(3)13-14-23(31)25-16-29/h8,10-12,16,18-19,30H,9,13-15,17H2,1-7H3,(H,25,29,31)/b20-11+/t19-/m0/s1 |
| InChIKey | PDSYKWJENNIBHM-ATASCALFSA-N |
| XLogP | 2.94 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|