ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen

C10H18N2 — CID 143489798

IUPACethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen
SMILESCC.Cc1nc2c([nH]1)=CCCC=2.[H][H]
InChIInChI=1S/C8H10N2.C2H6.H2/c1-6-9-7-4-2-3-5-8(7)10-6;1-2;/h4-5H,2-3H2,1H3,(H,9,10);1-2H3;1H
InChIKeyOABIMDUSLPAZKZ-UHFFFAOYSA-N
MW166.27 g/mol
LogP1.35
Rot. Bonds

About ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen

ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen (PubChem CID 143489798) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen.

Molecular Properties

Compound Nameethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen
PubChem CID143489798
Molecular FormulaC10H18N2
Molecular Weight166.27 g/mol
Exact Mass166.15
IUPAC Nameethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen
SMILESCC.Cc1nc2c([nH]1)=CCCC=2.[H][H]
InChIInChI=1S/C8H10N2.C2H6.H2/c1-6-9-7-4-2-3-5-8(7)10-6;1-2;/h4-5H,2-3H2,1H3,(H,9,10);1-2H3;1H
InChIKeyOABIMDUSLPAZKZ-UHFFFAOYSA-N
XLogP1.35
TPSA28.68 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500166.27
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen?
The IUPAC name of ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen (CID 143489798) is ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen.
What is the SMILES notation for ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen?
The canonical SMILES for ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen is CC.Cc1nc2c([nH]1)=CCCC=2.[H][H].
What is the InChIKey of ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen?
The InChIKey is OABIMDUSLPAZKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2.C2H6.H2/c1-6-9-7-4-2-3-5-8(7)10-6;1-2;/h4-5H,2-3H2,1H3,(H,9,10);1-2H3;1H.
What are the key properties of ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen?
ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen has a molecular weight of 166.27 g/mol, XLogP of 1.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-5,6-dihydro-1H-benzimidazole;molecular hydrogen is sourced from PubChem (CID 143489798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).