C14H31N3O — CID 143490321
N-[(dipropylamino)methyl]acetamide;N-ethylprop-1-en-2-amine (PubChem CID 143490321) has the molecular formula C14H31N3O and a molecular weight of 257.42 g/mol. Its IUPAC name is N-[(dipropylamino)methyl]acetamide;N-ethylprop-1-en-2-amine.
| Compound Name | N-[(dipropylamino)methyl]acetamide;N-ethylprop-1-en-2-amine |
|---|---|
| PubChem CID | 143490321 |
| Molecular Formula | C14H31N3O |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | N-[(dipropylamino)methyl]acetamide;N-ethylprop-1-en-2-amine |
| SMILES | C=C(C)NCC.CCCN(CCC)CNC(C)=O |
| InChI | InChI=1S/C9H20N2O.C5H11N/c1-4-6-11(7-5-2)8-10-9(3)12;1-4-6-5(2)3/h4-8H2,1-3H3,(H,10,12);6H,2,4H2,1,3H3 |
| InChIKey | WHOKDMPHZQQLBP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|