C12H24N2O — CID 108910306
1,1-dibutyl-3-prop-1-en-2-ylurea (PubChem CID 108910306) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 1,1-dibutyl-3-prop-1-en-2-ylurea.
| Compound Name | 1,1-dibutyl-3-prop-1-en-2-ylurea |
|---|---|
| PubChem CID | 108910306 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 1,1-dibutyl-3-prop-1-en-2-ylurea |
| SMILES | C=C(C)NC(=O)N(CCCC)CCCC |
| InChI | InChI=1S/C12H24N2O/c1-5-7-9-14(10-8-6-2)12(15)13-11(3)4/h3,5-10H2,1-2,4H3,(H,13,15) |
| InChIKey | NPUTZXBUFOQKMJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |