C10H21N3O — CID 145488721
1-[(E)-but-2-en-2-yl]-3-[3-(ethylamino)propyl]urea (PubChem CID 145488721) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 1-[(E)-but-2-en-2-yl]-3-[3-(ethylamino)propyl]urea.
| Compound Name | 1-[(E)-but-2-en-2-yl]-3-[3-(ethylamino)propyl]urea |
|---|---|
| PubChem CID | 145488721 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 1-[(E)-but-2-en-2-yl]-3-[3-(ethylamino)propyl]urea |
| SMILES | C/C=C(\C)NC(=O)NCCCNCC |
| InChI | InChI=1S/C10H21N3O/c1-4-9(3)13-10(14)12-8-6-7-11-5-2/h4,11H,5-8H2,1-3H3,(H2,12,13,14)/b9-4+ |
| InChIKey | XVRQRFQSKMEMHA-RUDMXATFSA-N |
| XLogP | 1.21 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|