C15H33N3O — CID 142516752
1-[(2E,4E)-5-aminohexa-2,4-dien-2-yl]-3-propan-2-ylurea;ethane;propane (PubChem CID 142516752) has the molecular formula C15H33N3O and a molecular weight of 271.45 g/mol. Its IUPAC name is 1-[(2E,4E)-5-aminohexa-2,4-dien-2-yl]-3-propan-2-ylurea;ethane;propane.
| Compound Name | 1-[(2E,4E)-5-aminohexa-2,4-dien-2-yl]-3-propan-2-ylurea;ethane;propane |
|---|---|
| PubChem CID | 142516752 |
| Molecular Formula | C15H33N3O |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.26 |
| IUPAC Name | 1-[(2E,4E)-5-aminohexa-2,4-dien-2-yl]-3-propan-2-ylurea;ethane;propane |
| SMILES | C/C(N)=C\C=C(/C)NC(=O)NC(C)C.CC.CCC |
| InChI | InChI=1S/C10H19N3O.C3H8.C2H6/c1-7(2)12-10(14)13-9(4)6-5-8(3)11;1-3-2;1-2/h5-7H,11H2,1-4H3,(H2,12,13,14);3H2,1-2H3;1-2H3/b8-5+,9-6+;; |
| InChIKey | QZUGGNJTOVOVKH-MLHUQVQXSA-N |
| XLogP | 3.90 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|