C14H31N3O — CID 143490425
N-ethylacetamide;N-prop-1-en-2-yl-N',N'-dipropylmethanediamine (PubChem CID 143490425) has the molecular formula C14H31N3O and a molecular weight of 257.42 g/mol. Its IUPAC name is N-ethylacetamide;N-prop-1-en-2-yl-N',N'-dipropylmethanediamine.
| Compound Name | N-ethylacetamide;N-prop-1-en-2-yl-N',N'-dipropylmethanediamine |
|---|---|
| PubChem CID | 143490425 |
| Molecular Formula | C14H31N3O |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | N-ethylacetamide;N-prop-1-en-2-yl-N',N'-dipropylmethanediamine |
| SMILES | C=C(C)NCN(CCC)CCC.CCNC(C)=O |
| InChI | InChI=1S/C10H22N2.C4H9NO/c1-5-7-12(8-6-2)9-11-10(3)4;1-3-5-4(2)6/h11H,3,5-9H2,1-2,4H3;3H2,1-2H3,(H,5,6) |
| InChIKey | ASRCODZUTGPTAH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|