C12H24N2O — CID 145170261
ethane;1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-propylurea (PubChem CID 145170261) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is ethane;1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-propylurea.
| Compound Name | ethane;1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-propylurea |
|---|---|
| PubChem CID | 145170261 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | ethane;1-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-propylurea |
| SMILES | C/C=C\C(=C/C)NC(=O)NCCC.CC |
| InChI | InChI=1S/C10H18N2O.C2H6/c1-4-7-9(6-3)12-10(13)11-8-5-2;1-2/h4,6-7H,5,8H2,1-3H3,(H2,11,12,13);1-2H3/b7-4-,9-6+; |
| InChIKey | VPHAQIVPFUJVMU-XEAPTMNZSA-N |
| XLogP | 3.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|