C31H39NO — CID 143490736
N-[3-[5-[2-ethenyl-1-[(Z)-prop-1-enyl]-3H-inden-5-yl]pentyl]phenyl]acetamide;2-methylprop-1-ene (PubChem CID 143490736) has the molecular formula C31H39NO and a molecular weight of 441.66 g/mol. Its IUPAC name is N-[3-[5-[2-ethenyl-1-[(Z)-prop-1-enyl]-3H-inden-5-yl]pentyl]phenyl]acetamide;2-methylprop-1-ene.
| Compound Name | N-[3-[5-[2-ethenyl-1-[(Z)-prop-1-enyl]-3H-inden-5-yl]pentyl]phenyl]acetamide;2-methylprop-1-ene |
|---|---|
| PubChem CID | 143490736 |
| Molecular Formula | C31H39NO |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | N-[3-[5-[2-ethenyl-1-[(Z)-prop-1-enyl]-3H-inden-5-yl]pentyl]phenyl]acetamide;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=CC1=C(/C=C\C)c2ccc(CCCCCc3cccc(NC(C)=O)c3)cc2C1 |
| InChI | InChI=1S/C27H31NO.C4H8/c1-4-10-26-23(5-2)19-24-17-22(15-16-27(24)26)12-8-6-7-11-21-13-9-14-25(18-21)28-20(3)29;1-4(2)3/h4-5,9-10,13-18H,2,6-8,11-12,19H2,1,3H3,(H,28,29);1H2,2-3H3/b10-4-; |
| InChIKey | WGXWKPYDSWTYLY-MDZFRNKHSA-N |
| XLogP | 8.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|