C23H32Cl2N4O3S — CID 143491979
tert-butyl [2-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-4-prop-2-enylpiperazin-1-yl]sulfanylformate (PubChem CID 143491979) has the molecular formula C23H32Cl2N4O3S and a molecular weight of 515.51 g/mol. Its IUPAC name is tert-butyl [2-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-4-prop-2-enylpiperazin-1-yl]sulfanylformate.
| Compound Name | tert-butyl [2-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-4-prop-2-enylpiperazin-1-yl]sulfanylformate |
|---|---|
| PubChem CID | 143491979 |
| Molecular Formula | C23H32Cl2N4O3S |
| Molecular Weight | 515.51 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | tert-butyl [2-[4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-4-prop-2-enylpiperazin-1-yl]sulfanylformate |
| SMILES | C=CCN1CCN(SC(=O)OC(C)(C)C)C(C(=O)N2CCN(c3ccc(Cl)c(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C23H32Cl2N4O3S/c1-5-8-26-9-14-29(33-22(31)32-23(2,3)4)20(16-26)21(30)28-12-10-27(11-13-28)17-6-7-18(24)19(25)15-17/h5-7,15,20H,1,8-14,16H2,2-4H3 |
| InChIKey | JWLJQVMOZUQNEM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|