C26H40N4O2 — CID 143494474
methanamine;[4-[3-[4-[3-(4-methanimidoylphenoxy)propyl]piperidin-1-yl]propoxy]phenyl]methanamine (PubChem CID 143494474) has the molecular formula C26H40N4O2 and a molecular weight of 440.63 g/mol. Its IUPAC name is methanamine;[4-[3-[4-[3-(4-methanimidoylphenoxy)propyl]piperidin-1-yl]propoxy]phenyl]methanamine.
| Compound Name | methanamine;[4-[3-[4-[3-(4-methanimidoylphenoxy)propyl]piperidin-1-yl]propoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 143494474 |
| Molecular Formula | C26H40N4O2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.32 |
| IUPAC Name | methanamine;[4-[3-[4-[3-(4-methanimidoylphenoxy)propyl]piperidin-1-yl]propoxy]phenyl]methanamine |
| SMILES | CN.[H]/N=C/c1ccc(OCCCC2CCN(CCCOc3ccc(CN)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H35N3O2.CH5N/c26-19-22-4-8-24(9-5-22)29-17-1-3-21-12-15-28(16-13-21)14-2-18-30-25-10-6-23(20-27)7-11-25;1-2/h4-11,19,21,26H,1-3,12-18,20,27H2;2H2,1H3/b26-19+; |
| InChIKey | WUFUZYOPPCGZNE-MGXPCBRFSA-N |
| XLogP | 4.06 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|