C20H31NO — CID 143495123
(3E)-3-cyclohepta-2,4-dien-1-ylidene-1-(4-methylcyclohexyl)-2-methyliminopropan-1-one;ethane (PubChem CID 143495123) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (3E)-3-cyclohepta-2,4-dien-1-ylidene-1-(4-methylcyclohexyl)-2-methyliminopropan-1-one;ethane.
| Compound Name | (3E)-3-cyclohepta-2,4-dien-1-ylidene-1-(4-methylcyclohexyl)-2-methyliminopropan-1-one;ethane |
|---|---|
| PubChem CID | 143495123 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (3E)-3-cyclohepta-2,4-dien-1-ylidene-1-(4-methylcyclohexyl)-2-methyliminopropan-1-one;ethane |
| SMILES | C/N=C(/C=C1/C=CC=CCC1)C(=O)C1CCC(C)CC1.CC |
| InChI | InChI=1S/C18H25NO.C2H6/c1-14-9-11-16(12-10-14)18(20)17(19-2)13-15-7-5-3-4-6-8-15;1-2/h3-5,7,13-14,16H,6,8-12H2,1-2H3;1-2H3/b15-13-,19-17-; |
| InChIKey | SFQHDBJJBIQUFT-ILGPCLALSA-N |
| XLogP | 5.31 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|