C21H39N — CID 143495174
ethane;1,1,2,3,3,6,6-heptamethylcyclohepta[c]pyrrole;propane (PubChem CID 143495174) has the molecular formula C21H39N and a molecular weight of 305.55 g/mol. Its IUPAC name is ethane;1,1,2,3,3,6,6-heptamethylcyclohepta[c]pyrrole;propane.
| Compound Name | ethane;1,1,2,3,3,6,6-heptamethylcyclohepta[c]pyrrole;propane |
|---|---|
| PubChem CID | 143495174 |
| Molecular Formula | C21H39N |
| Molecular Weight | 305.55 g/mol |
| Exact Mass | 305.31 |
| IUPAC Name | ethane;1,1,2,3,3,6,6-heptamethylcyclohepta[c]pyrrole;propane |
| SMILES | CC.CCC.CN1C(C)(C)C2=C(C=CC(C)(C)C=C2)C1(C)C |
| InChI | InChI=1S/C16H25N.C3H8.C2H6/c1-14(2)10-8-12-13(9-11-14)16(5,6)17(7)15(12,3)4;1-3-2;1-2/h8-11H,1-7H3;3H2,1-2H3;1-2H3 |
| InChIKey | XIYBYUAXISDQGH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.55 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |