C19H35N — CID 155001490
(4Z)-N-(3,3-dimethylbutyl)-N,2,6,7-tetramethyl-3-methylideneocta-4,6-dien-2-amine (PubChem CID 155001490) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is (4Z)-N-(3,3-dimethylbutyl)-N,2,6,7-tetramethyl-3-methylideneocta-4,6-dien-2-amine.
| Compound Name | (4Z)-N-(3,3-dimethylbutyl)-N,2,6,7-tetramethyl-3-methylideneocta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 155001490 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | (4Z)-N-(3,3-dimethylbutyl)-N,2,6,7-tetramethyl-3-methylideneocta-4,6-dien-2-amine |
| SMILES | C=C(/C=C\C(C)=C(C)C)C(C)(C)N(C)CCC(C)(C)C |
| InChI | InChI=1S/C19H35N/c1-15(2)16(3)11-12-17(4)19(8,9)20(10)14-13-18(5,6)7/h11-12H,4,13-14H2,1-3,5-10H3/b12-11- |
| InChIKey | ZQUJJKZVUPNRIZ-QXMHVHEDSA-N |
| XLogP | 5.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|