C16H25N — CID 143495175
1,1,2,3,3,6,6-heptamethylcyclohepta[c]pyrrole (PubChem CID 143495175) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is 1,1,2,3,3,6,6-heptamethylcyclohepta[c]pyrrole.
| Compound Name | 1,1,2,3,3,6,6-heptamethylcyclohepta[c]pyrrole |
|---|---|
| PubChem CID | 143495175 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 1,1,2,3,3,6,6-heptamethylcyclohepta[c]pyrrole |
| SMILES | CN1C(C)(C)C2=C(C=CC(C)(C)C=C2)C1(C)C |
| InChI | InChI=1S/C16H25N/c1-14(2)10-8-12-13(9-11-14)16(5,6)17(7)15(12,3)4/h8-11H,1-7H3 |
| InChIKey | OEXJMDZXKYZGFD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |