C14H21NO — CID 143497139
(10aR)-10-ethenyl-2,5,5a,6,7,8,9,9a,10,10a-decahydro-1H-pyrrolo[1,2-b]isoquinolin-3-one (PubChem CID 143497139) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (10aR)-10-ethenyl-2,5,5a,6,7,8,9,9a,10,10a-decahydro-1H-pyrrolo[1,2-b]isoquinolin-3-one.
| Compound Name | (10aR)-10-ethenyl-2,5,5a,6,7,8,9,9a,10,10a-decahydro-1H-pyrrolo[1,2-b]isoquinolin-3-one |
|---|---|
| PubChem CID | 143497139 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (10aR)-10-ethenyl-2,5,5a,6,7,8,9,9a,10,10a-decahydro-1H-pyrrolo[1,2-b]isoquinolin-3-one |
| SMILES | C=CC1C2CCCCC2CN2C(=O)CC[C@H]12 |
| InChI | InChI=1S/C14H21NO/c1-2-11-12-6-4-3-5-10(12)9-15-13(11)7-8-14(15)16/h2,10-13H,1,3-9H2/t10?,11?,12?,13-/m1/s1 |
| InChIKey | GAVGDRNKDUKDAM-NODFVKRRSA-N |
| XLogP | 2.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|