C17H29IN2O — CID 44655766
(2S)-13-ethyl-7-aza-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one iodide (PubChem CID 44655766) has the molecular formula C17H29IN2O and a molecular weight of 404.34 g/mol. Its IUPAC name is (2S)-13-ethyl-7-aza-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one iodide.
| Compound Name | (2S)-13-ethyl-7-aza-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one iodide |
|---|---|
| PubChem CID | 44655766 |
| Molecular Formula | C17H29IN2O |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (2S)-13-ethyl-7-aza-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one iodide |
| SMILES | CC[N+]12CCCC3CN4C(=O)CCC[C@H]4C(CCC1)C32.[I-] |
| InChI | InChI=1S/C17H29N2O.HI/c1-2-19-10-4-6-13-12-18-15(8-3-9-16(18)20)14(17(13)19)7-5-11-19;/h13-15,17H,2-12H2,1H3;1H/q+1;/p-1/t13?,14?,15-,17?,19?;/m0./s1 |
| InChIKey | INKGNVXVJRHEAC-HNYRFXKFSA-M |
| XLogP | -0.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|