C14H22N2O2 — CID 163184629
(1S,2S,9S,10R,14R)-14-oxido-7-aza-14-azoniatetracyclo[7.6.1.02,7.010,14]hexadecan-6-one (PubChem CID 163184629) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1S,2S,9S,10R,14R)-14-oxido-7-aza-14-azoniatetracyclo[7.6.1.02,7.010,14]hexadecan-6-one.
| Compound Name | (1S,2S,9S,10R,14R)-14-oxido-7-aza-14-azoniatetracyclo[7.6.1.02,7.010,14]hexadecan-6-one |
|---|---|
| PubChem CID | 163184629 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (1S,2S,9S,10R,14R)-14-oxido-7-aza-14-azoniatetracyclo[7.6.1.02,7.010,14]hexadecan-6-one |
| SMILES | O=C1CCC[C@H]2[C@H]3C[C@@H](CN12)[C@H]1CCC[N@@+]1([O-])C3 |
| InChI | InChI=1S/C14H22N2O2/c17-14-5-1-3-12-11-7-10(8-15(12)14)13-4-2-6-16(13,18)9-11/h10-13H,1-9H2/t10-,11-,12-,13+,16+/m0/s1 |
| InChIKey | LQWHGNOORGACQX-VGBQHSPPSA-N |
| XLogP | 1.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|