C16H28N2O — CID 101210030
(2S,9S,10R)-6-methyl-15-oxido-7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecane (PubChem CID 101210030) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is (2S,9S,10R)-6-methyl-15-oxido-7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecane.
| Compound Name | (2S,9S,10R)-6-methyl-15-oxido-7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecane |
|---|---|
| PubChem CID | 101210030 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | (2S,9S,10R)-6-methyl-15-oxido-7-aza-15-azoniatetracyclo[7.7.1.02,7.010,15]heptadecane |
| SMILES | CC1CCC[C@H]2C3C[C@@H](CN12)[C@H]1CCCC[N+]1([O-])C3 |
| InChI | InChI=1S/C16H28N2O/c1-12-5-4-6-15-14-9-13(10-17(12)15)16-7-2-3-8-18(16,19)11-14/h12-16H,2-11H2,1H3/t12?,13-,14?,15-,16+,18?/m0/s1 |
| InChIKey | OWSUTOQYINXGMT-YYWATJFZSA-N |
| XLogP | 2.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|