C15H26N2O — CID 134865043
(7S,9R)-7-oxido-15-aza-7-azoniatetracyclo[7.7.1.02,7.010,15]heptadecane (PubChem CID 134865043) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is (7S,9R)-7-oxido-15-aza-7-azoniatetracyclo[7.7.1.02,7.010,15]heptadecane.
| Compound Name | (7S,9R)-7-oxido-15-aza-7-azoniatetracyclo[7.7.1.02,7.010,15]heptadecane |
|---|---|
| PubChem CID | 134865043 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | (7S,9R)-7-oxido-15-aza-7-azoniatetracyclo[7.7.1.02,7.010,15]heptadecane |
| SMILES | [O-][N@+]12CCCCC1C1C[C@H](C2)C2CCCCN2C1 |
| InChI | InChI=1S/C15H26N2O/c18-17-8-4-2-6-15(17)12-9-13(11-17)14-5-1-3-7-16(14)10-12/h12-15H,1-11H2/t12?,13-,14?,15?,17+/m1/s1 |
| InChIKey | KKWIHISLPLFWKM-CFWQKHAZSA-N |
| XLogP | 2.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|