C10H15NO3 — CID 130763796
(3aR,8aS,9R,9aR)-9-hydroxy-3,3a,4,7,8,8a,9,9a-octahydro-2H-furo[3,2-f]indolizin-6-one (PubChem CID 130763796) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (3aR,8aS,9R,9aR)-9-hydroxy-3,3a,4,7,8,8a,9,9a-octahydro-2H-furo[3,2-f]indolizin-6-one.
| Compound Name | (3aR,8aS,9R,9aR)-9-hydroxy-3,3a,4,7,8,8a,9,9a-octahydro-2H-furo[3,2-f]indolizin-6-one |
|---|---|
| PubChem CID | 130763796 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (3aR,8aS,9R,9aR)-9-hydroxy-3,3a,4,7,8,8a,9,9a-octahydro-2H-furo[3,2-f]indolizin-6-one |
| SMILES | O=C1CC[C@H]2[C@@H](O)[C@@H]3OCC[C@@H]3CN12 |
| InChI | InChI=1S/C10H15NO3/c12-8-2-1-7-9(13)10-6(3-4-14-10)5-11(7)8/h6-7,9-10,13H,1-5H2/t6-,7+,9-,10-/m1/s1 |
| InChIKey | XLDSIEAUGLXKQG-BKFJMODKSA-N |
| XLogP | -0.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |