C32H44N4O2 — CID 143497746
3-tert-butyl-N-[3-[N-[2-(ethylcarbamoyl)prop-2-enyl]-C-methylcarbonimidoyl]-4-methylphenyl]-5-(piperidin-1-ylmethyl)benzamide (PubChem CID 143497746) has the molecular formula C32H44N4O2 and a molecular weight of 516.73 g/mol. Its IUPAC name is 3-tert-butyl-N-[3-[N-[2-(ethylcarbamoyl)prop-2-enyl]-C-methylcarbonimidoyl]-4-methylphenyl]-5-(piperidin-1-ylmethyl)benzamide.
| Compound Name | 3-tert-butyl-N-[3-[N-[2-(ethylcarbamoyl)prop-2-enyl]-C-methylcarbonimidoyl]-4-methylphenyl]-5-(piperidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 143497746 |
| Molecular Formula | C32H44N4O2 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | 3-tert-butyl-N-[3-[N-[2-(ethylcarbamoyl)prop-2-enyl]-C-methylcarbonimidoyl]-4-methylphenyl]-5-(piperidin-1-ylmethyl)benzamide |
| SMILES | C=C(C/N=C(\C)c1cc(NC(=O)c2cc(CN3CCCCC3)cc(C(C)(C)C)c2)ccc1C)C(=O)NCC |
| InChI | InChI=1S/C32H44N4O2/c1-8-33-30(37)23(3)20-34-24(4)29-19-28(13-12-22(29)2)35-31(38)26-16-25(17-27(18-26)32(5,6)7)21-36-14-10-9-11-15-36/h12-13,16-19H,3,8-11,14-15,20-21H2,1-2,4-7H3,(H,33,37)(H,35,38)/b34-24+ |
| InChIKey | XPJDIOJLKALUHU-JGRMKTMXSA-N |
| XLogP | 6.03 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|