C19H23B2BrF2O6 — CID 143501324
2-[(2-bromo-5-fluorophenyl)methoxy]-1,3,2-dioxaborepane;(5-fluoro-2-methylphenyl)methoxyboronic acid (PubChem CID 143501324) has the molecular formula C19H23B2BrF2O6 and a molecular weight of 486.91 g/mol. Its IUPAC name is 2-[(2-bromo-5-fluorophenyl)methoxy]-1,3,2-dioxaborepane;(5-fluoro-2-methylphenyl)methoxyboronic acid.
| Compound Name | 2-[(2-bromo-5-fluorophenyl)methoxy]-1,3,2-dioxaborepane;(5-fluoro-2-methylphenyl)methoxyboronic acid |
|---|---|
| PubChem CID | 143501324 |
| Molecular Formula | C19H23B2BrF2O6 |
| Molecular Weight | 486.91 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | 2-[(2-bromo-5-fluorophenyl)methoxy]-1,3,2-dioxaborepane;(5-fluoro-2-methylphenyl)methoxyboronic acid |
| SMILES | Cc1ccc(F)cc1COB(O)O.Fc1ccc(Br)c(COB2OCCCCO2)c1 |
| InChI | InChI=1S/C11H13BBrFO3.C8H10BFO3/c13-11-4-3-10(14)7-9(11)8-17-12-15-5-1-2-6-16-12;1-6-2-3-8(10)4-7(6)5-13-9(11)12/h3-4,7H,1-2,5-6,8H2;2-4,11-12H,5H2,1H3 |
| InChIKey | XLMIRCXIHDEPIX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.91 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|