C19H24BN3O4 — CID 143502007
[(E)-4-[[2-(6-amino-6-oxohexan-3-yl)-1,3-dioxoisoindol-4-yl]amino]-3-methylbut-2-enylidene]borinic acid (PubChem CID 143502007) has the molecular formula C19H24BN3O4 and a molecular weight of 369.23 g/mol. Its IUPAC name is [(E)-4-[[2-(6-amino-6-oxohexan-3-yl)-1,3-dioxoisoindol-4-yl]amino]-3-methylbut-2-enylidene]borinic acid.
| Compound Name | [(E)-4-[[2-(6-amino-6-oxohexan-3-yl)-1,3-dioxoisoindol-4-yl]amino]-3-methylbut-2-enylidene]borinic acid |
|---|---|
| PubChem CID | 143502007 |
| Molecular Formula | C19H24BN3O4 |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [(E)-4-[[2-(6-amino-6-oxohexan-3-yl)-1,3-dioxoisoindol-4-yl]amino]-3-methylbut-2-enylidene]borinic acid |
| SMILES | CCC(CCC(N)=O)N1C(=O)c2cccc(NC/C(C)=C/C=B/O)c2C1=O |
| InChI | InChI=1S/C19H24BN3O4/c1-3-13(7-8-16(21)24)23-18(25)14-5-4-6-15(17(14)19(23)26)22-11-12(2)9-10-20-27/h4-6,9-10,13,22,27H,3,7-8,11H2,1-2H3,(H2,21,24)/b12-9+ |
| InChIKey | GPWFUPLRAOBYTE-FMIVXFBMSA-N |
| XLogP | 1.10 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|