C9H15N3 — CID 143502394
4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-ylmethanamine (PubChem CID 143502394) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-ylmethanamine.
| Compound Name | 4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-ylmethanamine |
|---|---|
| PubChem CID | 143502394 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-2-ylmethanamine |
| SMILES | NCC1=NC2NCCCC2C=C1 |
| InChI | InChI=1S/C9H15N3/c10-6-8-4-3-7-2-1-5-11-9(7)12-8/h3-4,7,9,11H,1-2,5-6,10H2 |
| InChIKey | PGSIIQSJCJIWHK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |