C34H48F2N4O3 — CID 143502666
N-[2-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]oxyethyl]-N'-[3-(7-methoxy-3-methylindol-1-yl)propyl]-N'-propylethane-1,2-diamine;N-[(3-fluorophenyl)methyl]formamide (PubChem CID 143502666) has the molecular formula C34H48F2N4O3 and a molecular weight of 598.78 g/mol. Its IUPAC name is N-[2-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]oxyethyl]-N'-[3-(7-methoxy-3-methylindol-1-yl)propyl]-N'-propylethane-1,2-diamine;N-[(3-fluorophenyl)methyl]formamide.
| Compound Name | N-[2-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]oxyethyl]-N'-[3-(7-methoxy-3-methylindol-1-yl)propyl]-N'-propylethane-1,2-diamine;N-[(3-fluorophenyl)methyl]formamide |
|---|---|
| PubChem CID | 143502666 |
| Molecular Formula | C34H48F2N4O3 |
| Molecular Weight | 598.78 g/mol |
| Exact Mass | 598.37 |
| IUPAC Name | N-[2-[(2E,4E)-5-fluorohexa-2,4-dien-2-yl]oxyethyl]-N'-[3-(7-methoxy-3-methylindol-1-yl)propyl]-N'-propylethane-1,2-diamine;N-[(3-fluorophenyl)methyl]formamide |
| SMILES | CCCN(CCCn1cc(C)c2cccc(OC)c21)CCNCCO/C(C)=C/C=C(\C)F.O=CNCc1cccc(F)c1 |
| InChI | InChI=1S/C26H40FN3O2.C8H8FNO/c1-6-15-29(18-13-28-14-19-32-23(4)12-11-22(3)27)16-8-17-30-20-21(2)24-9-7-10-25(31-5)26(24)30;9-8-3-1-2-7(4-8)5-10-6-11/h7,9-12,20,28H,6,8,13-19H2,1-5H3;1-4,6H,5H2,(H,10,11)/b22-11+,23-12+; |
| InChIKey | VYGPBMKBURIUFG-MVRUJIMNSA-N |
| XLogP | 6.52 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.78 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|