C12H21F3N2 — CID 143502750
(1Z,3Z)-1-N',1-N'-dipropyl-2-(trifluoromethyl)penta-1,3-diene-1,1-diamine (PubChem CID 143502750) has the molecular formula C12H21F3N2 and a molecular weight of 250.31 g/mol. Its IUPAC name is (1Z,3Z)-1-N',1-N'-dipropyl-2-(trifluoromethyl)penta-1,3-diene-1,1-diamine.
| Compound Name | (1Z,3Z)-1-N',1-N'-dipropyl-2-(trifluoromethyl)penta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 143502750 |
| Molecular Formula | C12H21F3N2 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (1Z,3Z)-1-N',1-N'-dipropyl-2-(trifluoromethyl)penta-1,3-diene-1,1-diamine |
| SMILES | C/C=C\C(=C(/N)N(CCC)CCC)C(F)(F)F |
| InChI | InChI=1S/C12H21F3N2/c1-4-7-10(12(13,14)15)11(16)17(8-5-2)9-6-3/h4,7H,5-6,8-9,16H2,1-3H3/b7-4-,11-10- |
| InChIKey | GELHYNUZHHUMDA-ZDXSPKKTSA-N |
| XLogP | 3.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|