C10H17F3N2 — CID 162563285
(1E,3E)-1-N'-propyl-4-(trifluoromethyl)hexa-1,3-diene-1,1-diamine (PubChem CID 162563285) has the molecular formula C10H17F3N2 and a molecular weight of 222.25 g/mol. Its IUPAC name is (1E,3E)-1-N'-propyl-4-(trifluoromethyl)hexa-1,3-diene-1,1-diamine.
| Compound Name | (1E,3E)-1-N'-propyl-4-(trifluoromethyl)hexa-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 162563285 |
| Molecular Formula | C10H17F3N2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (1E,3E)-1-N'-propyl-4-(trifluoromethyl)hexa-1,3-diene-1,1-diamine |
| SMILES | CCCN/C(N)=C/C=C(\CC)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2/c1-3-7-15-9(14)6-5-8(4-2)10(11,12)13/h5-6,15H,3-4,7,14H2,1-2H3/b8-5+,9-6+ |
| InChIKey | KGDVPFSRJQHVQG-XVYDYJIPSA-N |
| XLogP | 2.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|