C12H18F2N2 — CID 155728285
1-N'-[(2E,3E,5E)-3,5-difluoro-2-propylidenehepta-3,5-dienyl]ethene-1,1-diamine (PubChem CID 155728285) has the molecular formula C12H18F2N2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-N'-[(2E,3E,5E)-3,5-difluoro-2-propylidenehepta-3,5-dienyl]ethene-1,1-diamine.
| Compound Name | 1-N'-[(2E,3E,5E)-3,5-difluoro-2-propylidenehepta-3,5-dienyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 155728285 |
| Molecular Formula | C12H18F2N2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-N'-[(2E,3E,5E)-3,5-difluoro-2-propylidenehepta-3,5-dienyl]ethene-1,1-diamine |
| SMILES | C=C(N)NCC(=C\CC)/C(F)=C\C(F)=C/C |
| InChI | InChI=1S/C12H18F2N2/c1-4-6-10(8-16-9(3)15)12(14)7-11(13)5-2/h5-7,16H,3-4,8,15H2,1-2H3/b10-6+,11-5+,12-7+ |
| InChIKey | GEDHZDZZSTXXTD-CZXLTDDPSA-N |
| XLogP | 3.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|