C15H30N2 — CID 143178458
ethane;(1E,3Z,5Z)-1-N'-ethyl-2-methyl-1-N'-propylhepta-1,3,5-triene-1,1-diamine (PubChem CID 143178458) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is ethane;(1E,3Z,5Z)-1-N'-ethyl-2-methyl-1-N'-propylhepta-1,3,5-triene-1,1-diamine.
| Compound Name | ethane;(1E,3Z,5Z)-1-N'-ethyl-2-methyl-1-N'-propylhepta-1,3,5-triene-1,1-diamine |
|---|---|
| PubChem CID | 143178458 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | ethane;(1E,3Z,5Z)-1-N'-ethyl-2-methyl-1-N'-propylhepta-1,3,5-triene-1,1-diamine |
| SMILES | C/C=C\C=C/C(C)=C(\N)N(CC)CCC.CC |
| InChI | InChI=1S/C13H24N2.C2H6/c1-5-8-9-10-12(4)13(14)15(7-3)11-6-2;1-2/h5,8-10H,6-7,11,14H2,1-4H3;1-2H3/b8-5-,10-9-,13-12+; |
| InChIKey | LLRVUNVLXGWCPH-LSHYLPCBSA-N |
| XLogP | 4.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|