C28H34N4O — CID 143509400
1-[4-(3-cyano-1-cyclobutyl-6-pentylindol-2-yl)phenyl]-3-propan-2-ylurea (PubChem CID 143509400) has the molecular formula C28H34N4O and a molecular weight of 442.61 g/mol. Its IUPAC name is 1-[4-(3-cyano-1-cyclobutyl-6-pentylindol-2-yl)phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-(3-cyano-1-cyclobutyl-6-pentylindol-2-yl)phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 143509400 |
| Molecular Formula | C28H34N4O |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | 1-[4-(3-cyano-1-cyclobutyl-6-pentylindol-2-yl)phenyl]-3-propan-2-ylurea |
| SMILES | CCCCCc1ccc2c(C#N)c(-c3ccc(NC(=O)NC(C)C)cc3)n(C3CCC3)c2c1 |
| InChI | InChI=1S/C28H34N4O/c1-4-5-6-8-20-11-16-24-25(18-29)27(32(26(24)17-20)23-9-7-10-23)21-12-14-22(15-13-21)31-28(33)30-19(2)3/h11-17,19,23H,4-10H2,1-3H3,(H2,30,31,33) |
| InChIKey | ODGCQMJIXZPUAY-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|