C30H29ClN4O2 — CID 143509770
2-(4-aminophenyl)-6-(6-chloro-2-pyridinyl)-1-cyclobutylindole-3-carbonitrile;[(1R)-1-cyclopropylethyl] formate (PubChem CID 143509770) has the molecular formula C30H29ClN4O2 and a molecular weight of 513.04 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-(6-chloro-2-pyridinyl)-1-cyclobutylindole-3-carbonitrile;[(1R)-1-cyclopropylethyl] formate.
| Compound Name | 2-(4-aminophenyl)-6-(6-chloro-2-pyridinyl)-1-cyclobutylindole-3-carbonitrile;[(1R)-1-cyclopropylethyl] formate |
|---|---|
| PubChem CID | 143509770 |
| Molecular Formula | C30H29ClN4O2 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 2-(4-aminophenyl)-6-(6-chloro-2-pyridinyl)-1-cyclobutylindole-3-carbonitrile;[(1R)-1-cyclopropylethyl] formate |
| SMILES | C[C@@H](OC=O)C1CC1.N#Cc1c(-c2ccc(N)cc2)n(C2CCC2)c2cc(-c3cccc(Cl)n3)ccc12 |
| InChI | InChI=1S/C24H19ClN4.C6H10O2/c25-23-6-2-5-21(28-23)16-9-12-19-20(14-26)24(15-7-10-17(27)11-8-15)29(22(19)13-16)18-3-1-4-18;1-5(8-4-7)6-2-3-6/h2,5-13,18H,1,3-4,27H2;4-6H,2-3H2,1H3/t;5-/m.1/s1 |
| InChIKey | OPOINODCUKKSKX-QDXATWJZSA-N |
| XLogP | 7.16 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|