C29H30N4O2S — CID 143511421
N-[4-(3-cyano-1-cyclobutyl-6-pyridin-2-ylindol-2-yl)phenyl]-2-methylbutane-1-sulfonamide (PubChem CID 143511421) has the molecular formula C29H30N4O2S and a molecular weight of 498.65 g/mol. Its IUPAC name is N-[4-(3-cyano-1-cyclobutyl-6-pyridin-2-ylindol-2-yl)phenyl]-2-methylbutane-1-sulfonamide.
| Compound Name | N-[4-(3-cyano-1-cyclobutyl-6-pyridin-2-ylindol-2-yl)phenyl]-2-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 143511421 |
| Molecular Formula | C29H30N4O2S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | N-[4-(3-cyano-1-cyclobutyl-6-pyridin-2-ylindol-2-yl)phenyl]-2-methylbutane-1-sulfonamide |
| SMILES | CCC(C)CS(=O)(=O)Nc1ccc(-c2c(C#N)c3ccc(-c4ccccn4)cc3n2C2CCC2)cc1 |
| InChI | InChI=1S/C29H30N4O2S/c1-3-20(2)19-36(34,35)32-23-13-10-21(11-14-23)29-26(18-30)25-15-12-22(27-9-4-5-16-31-27)17-28(25)33(29)24-7-6-8-24/h4-5,9-17,20,24,32H,3,6-8,19H2,1-2H3 |
| InChIKey | SIWQUCYIHOWTJQ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |