C19H19N3O5 — CID 143510127
(5R)-5-[[6-(4-hydroxybut-2-ynoxy)-3-oxo-1H-isoindol-2-yl]methyl]-5-prop-2-enylimidazolidine-2,4-dione (PubChem CID 143510127) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is (5R)-5-[[6-(4-hydroxybut-2-ynoxy)-3-oxo-1H-isoindol-2-yl]methyl]-5-prop-2-enylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-[[6-(4-hydroxybut-2-ynoxy)-3-oxo-1H-isoindol-2-yl]methyl]-5-prop-2-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143510127 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (5R)-5-[[6-(4-hydroxybut-2-ynoxy)-3-oxo-1H-isoindol-2-yl]methyl]-5-prop-2-enylimidazolidine-2,4-dione |
| SMILES | C=CC[C@]1(CN2Cc3cc(OCC#CCO)ccc3C2=O)NC(=O)NC1=O |
| InChI | InChI=1S/C19H19N3O5/c1-2-7-19(17(25)20-18(26)21-19)12-22-11-13-10-14(27-9-4-3-8-23)5-6-15(13)16(22)24/h2,5-6,10,23H,1,7-9,11-12H2,(H2,20,21,25,26)/t19-/m1/s1 |
| InChIKey | LKMKSRJCTFCBSG-LJQANCHMSA-N |
| XLogP | 0.17 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|