C12H13N3O2 — CID 143510979
5-methyl-N-(3-methylphenyl)-1,2-oxazole-3-carbohydrazide (PubChem CID 143510979) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 5-methyl-N-(3-methylphenyl)-1,2-oxazole-3-carbohydrazide.
| Compound Name | 5-methyl-N-(3-methylphenyl)-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 143510979 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 5-methyl-N-(3-methylphenyl)-1,2-oxazole-3-carbohydrazide |
| SMILES | Cc1cccc(N(N)C(=O)c2cc(C)on2)c1 |
| InChI | InChI=1S/C12H13N3O2/c1-8-4-3-5-10(6-8)15(13)12(16)11-7-9(2)17-14-11/h3-7H,13H2,1-2H3 |
| InChIKey | NCFDROSXDVLMLY-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|