C21H26N4O2S — CID 143512506
5-[2-[5-(aminomethyl)thiophen-3-yl]ethynyl]imidazolidin-4-one;5-ethyl-2-(methylaminomethyl)benzaldehyde (PubChem CID 143512506) has the molecular formula C21H26N4O2S and a molecular weight of 398.53 g/mol. Its IUPAC name is 5-[2-[5-(aminomethyl)thiophen-3-yl]ethynyl]imidazolidin-4-one;5-ethyl-2-(methylaminomethyl)benzaldehyde.
| Compound Name | 5-[2-[5-(aminomethyl)thiophen-3-yl]ethynyl]imidazolidin-4-one;5-ethyl-2-(methylaminomethyl)benzaldehyde |
|---|---|
| PubChem CID | 143512506 |
| Molecular Formula | C21H26N4O2S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 5-[2-[5-(aminomethyl)thiophen-3-yl]ethynyl]imidazolidin-4-one;5-ethyl-2-(methylaminomethyl)benzaldehyde |
| SMILES | CCc1ccc(CNC)c(C=O)c1.NCc1cc(C#CC2NCNC2=O)cs1 |
| InChI | InChI=1S/C11H15NO.C10H11N3OS/c1-3-9-4-5-10(7-12-2)11(6-9)8-13;11-4-8-3-7(5-15-8)1-2-9-10(14)13-6-12-9/h4-6,8,12H,3,7H2,1-2H3;3,5,9,12H,4,6,11H2,(H,13,14) |
| InChIKey | MJBYBOZQXCOIHJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|