C27H26N4O4 — CID 143512863
5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-[(Z)-3-methyl-6-methyliminohex-4-en-1-ynyl]phenyl]imidazolidine-2,4-dione (PubChem CID 143512863) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-[(Z)-3-methyl-6-methyliminohex-4-en-1-ynyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-[(Z)-3-methyl-6-methyliminohex-4-en-1-ynyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143512863 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[4-[(Z)-3-methyl-6-methyliminohex-4-en-1-ynyl]phenyl]imidazolidine-2,4-dione |
| SMILES | C/N=C/C=C\C(C)C#Cc1ccc(C2(CN3Cc4ccc(OC)cc4C3=O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C27H26N4O4/c1-18(5-4-14-28-2)6-7-19-8-11-21(12-9-19)27(25(33)29-26(34)30-27)17-31-16-20-10-13-22(35-3)15-23(20)24(31)32/h4-5,8-15,18H,16-17H2,1-3H3,(H2,29,30,33,34)/b5-4-,28-14+ |
| InChIKey | ZTYJJYLBLIWDEW-SPKXURJASA-N |
| XLogP | 2.63 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|