C22H21N3O — CID 143514289
(2E,4Z)-2-ethenyl-N-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methyl]hexa-2,4-dienamide (PubChem CID 143514289) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is (2E,4Z)-2-ethenyl-N-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methyl]hexa-2,4-dienamide.
| Compound Name | (2E,4Z)-2-ethenyl-N-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 143514289 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (2E,4Z)-2-ethenyl-N-[[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)phenyl]methyl]hexa-2,4-dienamide |
| SMILES | C=C/C(=C\C=C/C)C(=O)NCc1ccc(-c2ccnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C22H21N3O/c1-3-5-6-17(4-2)22(26)25-15-16-7-9-18(10-8-16)19-11-13-23-21-20(19)12-14-24-21/h3-14H,2,15H2,1H3,(H,23,24)(H,25,26)/b5-3-,17-6+ |
| InChIKey | GKHZESJGZPFQKK-UCHPOWPESA-N |
| XLogP | 4.53 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|